p-Hydroxyphenethyl trans-ferulate structure
|
Common Name | p-Hydroxyphenethyl trans-ferulate | ||
|---|---|---|---|---|
| CAS Number | 84873-15-4 | Molecular Weight | 314.33 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 530.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H18O5 | Melting Point | 168-169℃ | |
| MSDS | N/A | Flash Point | 193.3±23.6 °C | |
Use of p-Hydroxyphenethyl trans-ferulatep-Hydroxyphenethyl trans-ferulate has anti-hyperglycemic(yeast α-glucosidase,IC50 19.24 ± 1.73 µmol L-1), antioxidant, and anti-inflammatory activities[1]. p-Hydroxyphenethyl trans-ferulate shows inhibiting cancer preve |
| Name | p-Hydroxyphenethyl trans-ferulate |
|---|---|
| Synonym | More Synonyms |
| Description | p-Hydroxyphenethyl trans-ferulate has anti-hyperglycemic(yeast α-glucosidase,IC50 19.24 ± 1.73 µmol L-1), antioxidant, and anti-inflammatory activities[1]. p-Hydroxyphenethyl trans-ferulate shows inhibiting cancer preve |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 530.1±50.0 °C at 760 mmHg |
| Melting Point | 168-169℃ |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.33 |
| Flash Point | 193.3±23.6 °C |
| Exact Mass | 314.115417 |
| PSA | 75.99000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | JMSFLLZUCIXALN-WEVVVXLNSA-N |
| SMILES | COc1cc(C=CC(=O)OCCc2ccc(O)cc2)ccc1O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, 2-(4-hydroxyphenyl)ethyl ester, (2E)- |
| 2-(4-Hydroxyphenyl)ethyl (2E)-3-(4-hydroxy-3-methoxyphenyl)acrylate |
| 3-(4-Hydroxy-3-methoxy-phenyl)-acrylic acid 2-(4-hydroxy-phenyl)-ethyl ester |