pentabromo-N-(pentabromophenyl)aniline
Modify Date: 2025-08-22 11:33:49
pentabromo-N-(pentabromophenyl)aniline structure
|
Common Name | pentabromo-N-(pentabromophenyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 84852-54-0 | Molecular Weight | 958.18300 | |
| Density | 3.019g/cm3 | Boiling Point | 552.9ºC at 760 mmHg | |
| Molecular Formula | C12HBr10N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.2ºC | |
| Name | 2,3,4,5,6-pentabromo-N-(2,3,4,5,6-pentabromophenyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 3.019g/cm3 |
|---|---|
| Boiling Point | 552.9ºC at 760 mmHg |
| Molecular Formula | C12HBr10N |
| Molecular Weight | 958.18300 |
| Flash Point | 288.2ºC |
| Exact Mass | 948.19400 |
| PSA | 12.03000 |
| LogP | 11.12820 |
| Index of Refraction | 1.775 |
| InChIKey | OQXYDDOXOUGYNX-UHFFFAOYSA-N |
| SMILES | Brc1c(Br)c(Br)c(Nc2c(Br)c(Br)c(Br)c(Br)c2Br)c(Br)c1Br |
| HS Code | 2921499090 |
|---|
|
~%
pentabromo-N-(p... CAS#:84852-54-0 |
| Literature: Gessner Chemische Berichte, 1876 , vol. 9, p. 1509 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 284-367-4 |
| Bis-pentabromphenyl-amin |
| Dekabrom-diphenylamin |