pentabromo-alpha-phenylanisole
Modify Date: 2025-09-13 10:59:48
pentabromo-alpha-phenylanisole structure
|
Common Name | pentabromo-alpha-phenylanisole | ||
|---|---|---|---|---|
| CAS Number | 38521-49-2 | Molecular Weight | 578.71400 | |
| Density | 2.268g/cm3 | Boiling Point | 488.9ºC at 760mmHg | |
| Molecular Formula | C13H7Br5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.3ºC | |
| Name | 1,2,3,4,5-pentabromo-6-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.268g/cm3 |
|---|---|
| Boiling Point | 488.9ºC at 760mmHg |
| Molecular Formula | C13H7Br5O |
| Molecular Weight | 578.71400 |
| Flash Point | 204.3ºC |
| Exact Mass | 573.64100 |
| PSA | 9.23000 |
| LogP | 7.07810 |
| Index of Refraction | 1.675 |
| InChIKey | SMSGVBSSPGZMES-UHFFFAOYSA-N |
| SMILES | Brc1c(Br)c(Br)c(OCc2ccccc2)c(Br)c1Br |
| HS Code | 2909309090 |
|---|
|
~%
pentabromo-alph... CAS#:38521-49-2 |
| Literature: Auwers Justus Liebigs Annalen der Chemie, 1907 , vol. 357, p. 93 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzyl-pentabromphenyl-aether |
| benzyl-pentabromophenyl ether |
| Benzene,pentabromo(phenylmethoxy) |
| Pentabromophenyl benzyl ether |
| EINECS 253-984-0 |