Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate
Modify Date: 2025-12-01 12:07:04
Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate structure
|
Common Name | Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 848052-89-1 | Molecular Weight | 236.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 4-(2-methoxyphenyl)-2,4-dioxobutanoate |
|---|
| Molecular Formula | C12H12O5 |
|---|---|
| Molecular Weight | 236.22100 |
| Exact Mass | 236.06800 |
| PSA | 69.67000 |
| LogP | 1.01010 |
| InChIKey | JCPJQSOTWWRUKR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1ccccc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |