Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate
Modify Date: 2025-08-22 22:28:07
Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate structure
|
Common Name | Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 451485-68-0 | Molecular Weight | 240.640 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 343.4±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.9±21.3 °C | |
| Name | Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.4±22.0 °C at 760 mmHg |
| Molecular Formula | C11H9ClO4 |
| Molecular Weight | 240.640 |
| Flash Point | 143.9±21.3 °C |
| Exact Mass | 240.018936 |
| PSA | 60.44000 |
| LogP | 1.42 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | GNKBFLQRYZPLOA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1ccccc1Cl |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Methyl 4-(2-chlorophenyl)-2,4-dioxobutanoate |
| 4N-552S |
| Benzenebutanoic acid, 2-chloro-α,γ-dioxo-, methyl ester |
| Methyl 2-chloro-a,g-dioxo-benzenebutanoate |