2-[(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)methoxy]ethyl 2-aminoacetate structure
|
Common Name | 2-[(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)methoxy]ethyl 2-aminoacetate | ||
|---|---|---|---|---|
| CAS Number | 84499-61-6 | Molecular Weight | 284.27200 | |
| Density | 1.74g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H16N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-amino-6-oxo-4,5-dihydro-1H-purin-9-yl)methoxy]ethyl 2-aminoacetate |
|---|
| Density | 1.74g/cm3 |
|---|---|
| Molecular Formula | C10H16N6O4 |
| Molecular Weight | 284.27200 |
| Exact Mass | 284.12300 |
| PSA | 145.62000 |
| Index of Refraction | 1.73 |
| InChIKey | TYMAJVWKRIOWBD-UHFFFAOYSA-N |
| SMILES | NCC(=O)OCCOCN1C=NC2C(=O)NC(N)=NC21 |
|
~65%
2-[(2-amino-6-o... CAS#:84499-61-6 |
| Literature: Colla, Leon; Clercq, Erik De; Busson, Roger; Vanderhaeghe, Hubert Journal of Medicinal Chemistry, 1983 , vol. 26, # 4 p. 602 - 604 |
|
~%
2-[(2-amino-6-o... CAS#:84499-61-6 |
| Literature: Colla, Leon; Clercq, Erik De; Busson, Roger; Vanderhaeghe, Hubert Journal of Medicinal Chemistry, 1983 , vol. 26, # 4 p. 602 - 604 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |