(3,5-difluorophenyl)-(4-ethylphenyl)methanone
Modify Date: 2024-01-02 09:45:05
(3,5-difluorophenyl)-(4-ethylphenyl)methanone structure
|
Common Name | (3,5-difluorophenyl)-(4-ethylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 844885-11-6 | Molecular Weight | 246.25200 | |
| Density | 1.179g/cm3 | Boiling Point | 345.6ºC at 760 mmHg | |
| Molecular Formula | C15H12F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.4ºC | |
| Name | (3,5-difluorophenyl)-(4-ethylphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 345.6ºC at 760 mmHg |
| Molecular Formula | C15H12F2O |
| Molecular Weight | 246.25200 |
| Flash Point | 132.4ºC |
| Exact Mass | 246.08600 |
| PSA | 17.07000 |
| LogP | 3.75820 |
| Index of Refraction | 1.54 |
| InChIKey | HPRYOEMIUOVFEL-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)c2cc(F)cc(F)c2)cc1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,5-Difluoro-4'-ethylbenzophenone |