1-[hydroxy(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-ol
Modify Date: 2025-10-11 22:12:48
![1-[hydroxy(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-ol Structure](https://image.chemsrc.com/caspic/140/84418-31-5.png)
1-[hydroxy(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-ol structure
|
Common Name | 1-[hydroxy(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 84418-31-5 | Molecular Weight | 275.34300 | |
| Density | 1.181g/cm3 | Boiling Point | 482.5ºC at 760 mmHg | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.6ºC | |
| Name | 1-[hydroxy(propan-2-yl)amino]-3-naphthalen-1-yloxypropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 482.5ºC at 760 mmHg |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.34300 |
| Flash Point | 245.6ºC |
| Exact Mass | 275.15200 |
| PSA | 52.93000 |
| LogP | 2.67910 |
| Index of Refraction | 1.608 |
| InChIKey | VVODPHQSQSFBAF-UHFFFAOYSA-N |
| SMILES | CC(C)N(O)CC(O)COc1cccc2ccccc12 |
| HS Code | 2922509090 |
|---|
|
~%
1-[hydroxy(prop... CAS#:84418-31-5 |
| Literature: Zhang; Powell; Nelson; Wirth Journal of Medicinal Chemistry, 1983 , vol. 26, # 3 p. 455 - 458 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Hydroxypropranolol |