3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]benzaldehyde structure
|
Common Name | 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 84344-58-1 | Molecular Weight | 354.44300 | |
| Density | 1.14g/cm3 | Boiling Point | 535.8ºC at 760mmHg | |
| Molecular Formula | C21H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.8ºC | |
| Name | 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]benzaldehyde |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 535.8ºC at 760mmHg |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.44300 |
| Flash Point | 277.8ºC |
| Exact Mass | 354.19400 |
| PSA | 42.01000 |
| LogP | 3.10170 |
| Index of Refraction | 1.581 |
| InChIKey | QLUSPMVEXJZGDH-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(CCCOc3cccc(C=O)c3)CC2)cc1 |
|
~%
3-[3-[4-(4-meth... CAS#:84344-58-1 |
| Literature: Agarwal, Shiv K.; Kumar, Yatendra; Saxena, Anil K.; Jain, Padam C.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 5 p. 435 - 439 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |