[3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]methanol structure
|
Common Name | [3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 119335-96-5 | Molecular Weight | 356.45900 | |
| Density | 1.138g/cm3 | Boiling Point | 544.6ºC at 760 mmHg | |
| Molecular Formula | C21H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.2ºC | |
| Name | [3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propoxy]phenyl]methanol |
|---|
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 544.6ºC at 760 mmHg |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.45900 |
| Flash Point | 283.2ºC |
| Exact Mass | 356.21000 |
| PSA | 45.17000 |
| LogP | 2.78150 |
| Vapour Pressure | 1.08E-12mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | MREKWADEJIYKDJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(CCCOc3cccc(CO)c3)CC2)cc1 |
|
~77%
[3-[3-[4-(4-met... CAS#:119335-96-5 |
| Literature: Agarwal, Shiv K.; Saxena, Anil K.; Jain, Padam C.; Sur, R. N.; Srimal, Rikhab C.; et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 642 - 646 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |