chlozolinate
chlozolinate structure
|
Common Name | chlozolinate | ||
|---|---|---|---|---|
| CAS Number | 84332-86-5 | Molecular Weight | 332.13600 | |
| Density | 1.479g/cm3 | Boiling Point | 420.8ºC at 760 mmHg | |
| Molecular Formula | C13H11Cl2NO5 | Melting Point | 110-114ºC | |
| MSDS | N/A | Flash Point | 100ºC | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | chlozolinate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.479g/cm3 |
|---|---|
| Boiling Point | 420.8ºC at 760 mmHg |
| Melting Point | 110-114ºC |
| Molecular Formula | C13H11Cl2NO5 |
| Molecular Weight | 332.13600 |
| Flash Point | 100ºC |
| Exact Mass | 331.00100 |
| PSA | 72.91000 |
| LogP | 2.86340 |
| Index of Refraction | 1.57 |
| InChIKey | IGUYEXXAGBDLLX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C)OC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O |
| Storage condition | 0-6°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N,F |
| Risk Phrases | R40 |
| Safety Phrases | 36/37-61-62-60-33-25-16-9 |
| RIDADR | UN3077 9/PG 3 |
| HS Code | 2925190022 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2925190022 |
|---|---|
| Summary | 2925190022 ethyl 3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxooxazolidine-5-carboxylate |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| rac-ethyl (5R)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate |
| ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-1,3-oxazolidine-5-carboxylate |
| ethyl (RS)-3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxooxazolidine-5-carboxylate |
| ethyl 3-(3,5-dichlorophenyl)-5-methyl-2,4-dioxo-5-oxazolidinecarboxylate |
| N-(3,5-dichlorophenyl)-5-methyl-5-carboethoxy-1,3-oxazolidine-2,4-dione |
| Chlozolinate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of chlozolinate? |
| A: Melting point of chlozolinate is 110-114ºC. |
| Q: What is the polar surface area (PSA) of chlozolinate? |
| A: Polar surface area (PSA) of chlozolinate is 72.91000. |
| Q: What is the CAS number of chlozolinate? |
| A: CAS number of chlozolinate is 84332-86-5. |
| Q: What is the molecular weight of chlozolinate? |
| A: Molecular weight of chlozolinate is 332.13600. |
| Q: What is the safety information for chlozolinate? |
| A: Safety information for chlozolinate: 36/37-61-62-60-33-25-16-9. |
| Q: What is the English name of chlozolinate? |
| A: The English name of chlozolinate is chlozolinate. |
| Q: What is the LogP of chlozolinate? |
| A: LogP of chlozolinate is 2.86340. |
| Q: What is the SMILES notation of chlozolinate? |
| A: SMILES notation of chlozolinate is CCOC(=O)C1(C)OC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O. |
| Q: What is the boiling point of chlozolinate? |
| A: Boiling point of chlozolinate is 420.8ºC at 760 mmHg. |
| Q: What is the InChIKey of chlozolinate? |
| A: InChIKey of chlozolinate is IGUYEXXAGBDLLX-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |