methyl 1-[3,3-bis(benzenesulfonyl)butyl]-2-oxo-cyclopentane-1-carboxylate structure
|
Common Name | methyl 1-[3,3-bis(benzenesulfonyl)butyl]-2-oxo-cyclopentane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 84109-77-3 | Molecular Weight | 478.57800 | |
| Density | 1.313g/cm3 | Boiling Point | 682.1ºC at 760 mmHg | |
| Molecular Formula | C23H26O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 366.3ºC | |
| Name | methyl 1-[3,3-bis(benzenesulfonyl)butyl]-2-oxocyclopentane-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 682.1ºC at 760 mmHg |
| Molecular Formula | C23H26O7S2 |
| Molecular Weight | 478.57800 |
| Flash Point | 366.3ºC |
| Exact Mass | 478.11200 |
| PSA | 128.41000 |
| LogP | 5.50460 |
| Index of Refraction | 1.572 |
| InChIKey | JNDQMBNTHQDASL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCC(C)(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)CCCC1=O |
|
~%
methyl 1-[3,3-b... CAS#:84109-77-3 |
| Literature: Trost, Barry M.; Cossy, Janine; Burks, John Journal of the American Chemical Society, 1983 , vol. 105, # 4 p. 1052 - 1054 |
|
~%
methyl 1-[3,3-b... CAS#:84109-77-3 |
| Literature: Trost, Barry M.; Cossy, Janine; Burks, John Journal of the American Chemical Society, 1983 , vol. 105, # 4 p. 1052 - 1054 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| methyl 1-[3,3-bis(benzenesulfonyl)butyl]-2-oxo-cyclopentane-1-carboxylate |