ETHYL (R)-2-(TRIFLUOROMETHYLSULFONYLOXY)PROPIONATE structure
|
Common Name | ETHYL (R)-2-(TRIFLUOROMETHYLSULFONYLOXY)PROPIONATE | ||
|---|---|---|---|---|
| CAS Number | 84028-89-7 | Molecular Weight | 250.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H9F3O5S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | ethyl (2R)-2-(trifluoromethylsulfonyloxy)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H9F3O5S |
|---|---|
| Molecular Weight | 250.19300 |
| Exact Mass | 250.01200 |
| PSA | 78.05000 |
| LogP | 1.88500 |
| InChIKey | RYSBPHXTNVWICH-SCSAIBSYSA-N |
| SMILES | CCOC(=O)C(C)OS(=O)(=O)C(F)(F)F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| I04-8492 |
| Ethyl D-lactate 2-O-triflate |
| Ethyl O-trifluoromethanesulfonyl-D-lactate |
| MFCD00674552 |