4-Piperidinecarboxamide,4-(cyclohexylamino)- structure
|
Common Name | 4-Piperidinecarboxamide,4-(cyclohexylamino)- | ||
|---|---|---|---|---|
| CAS Number | 83877-87-6 | Molecular Weight | 225.33100 | |
| Density | 1.09g/cm3 | Boiling Point | 420.5ºC at 760 mmHg | |
| Molecular Formula | C12H23N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.1ºC | |
| Name | 4-(cyclohexylamino)piperidine-4-carboxamide |
|---|
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 420.5ºC at 760 mmHg |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.33100 |
| Flash Point | 208.1ºC |
| Exact Mass | 225.18400 |
| PSA | 67.15000 |
| LogP | 1.93620 |
| Index of Refraction | 1.537 |
| InChIKey | IUPNXQPHGAGYNA-UHFFFAOYSA-N |
| SMILES | NC(=O)C1(NC2CCCCC2)CCNCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |