4-Piperidinecarboxamide,4-(phenylamino)-
Modify Date: 2025-09-19 20:23:16
4-Piperidinecarboxamide,4-(phenylamino)- structure
|
Common Name | 4-Piperidinecarboxamide,4-(phenylamino)- | ||
|---|---|---|---|---|
| CAS Number | 37603-23-9 | Molecular Weight | 219.28300 | |
| Density | 1.189g/cm3 | Boiling Point | 460.8ºC at 760mmHg | |
| Molecular Formula | C12H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | 4-anilinopiperidine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 460.8ºC at 760mmHg |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.28300 |
| Flash Point | 232.5ºC |
| Exact Mass | 219.13700 |
| PSA | 67.15000 |
| LogP | 1.80810 |
| Index of Refraction | 1.607 |
| InChIKey | WAIIZELGDHTPRX-UHFFFAOYSA-N |
| SMILES | NC(=O)C1(Nc2ccccc2)CCNCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-anilino-piperidine-4-carboxylic acid amide |
| 4-anilino-4-piperidinecarboxamide |
| EINECS 253-566-8 |
| 4-anilino-4-carbamylpiperidine |