5-chloro-3-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzenesulphonic acid structure
|
Common Name | 5-chloro-3-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 83817-56-5 | Molecular Weight | 349.18700 | |
| Density | 1.644g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H10Cl2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-3-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.644g/cm3 |
|---|---|
| Molecular Formula | C13H10Cl2O5S |
| Molecular Weight | 349.18700 |
| Exact Mass | 347.96300 |
| PSA | 103.21000 |
| LogP | 4.32290 |
| Index of Refraction | 1.668 |
| InChIKey | HZCMTSWVWXUEDR-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(Cl)cc(Cc2cc(Cl)ccc2O)c1O |
| HS Code | 2908999090 |
|---|
|
~%
5-chloro-3-[(5-... CAS#:83817-56-5 |
| Literature: Faith Journal of the American Chemical Society, 1950 , vol. 72, p. 837 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| einecs 280-957-0 |