3,3'-methylenebis(5-chloro-2-hydroxybenzenesulphonic) acid
Modify Date: 2025-08-27 20:59:11
3,3'-methylenebis(5-chloro-2-hydroxybenzenesulphonic) acid structure
|
Common Name | 3,3'-methylenebis(5-chloro-2-hydroxybenzenesulphonic) acid | ||
|---|---|---|---|---|
| CAS Number | 83817-55-4 | Molecular Weight | 429.25000 | |
| Density | 1.825g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H10Cl2O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-3-[(5-chloro-2-hydroxy-3-sulfophenyl)methyl]-2-hydroxybenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.825g/cm3 |
|---|---|
| Molecular Formula | C13H10Cl2O8S2 |
| Molecular Weight | 429.25000 |
| Exact Mass | 427.91900 |
| PSA | 165.96000 |
| LogP | 4.65040 |
| Index of Refraction | 1.686 |
| InChIKey | BWTRVQLOHGVPIN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cc(Cl)cc(Cc2cc(Cl)cc(S(=O)(=O)O)c2O)c1O |
|
~%
3,3'-methyleneb... CAS#:83817-55-4 |
| Literature: Faith Journal of the American Chemical Society, 1950 , vol. 72, p. 837 |
![5-chloro-3-[(5-chloro-2-hydroxyphenyl)methyl]-2-hydroxybenzenesulphonic acid structure](https://image.chemsrc.com/caspic/087/83817-56-5.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| EINECS 280-956-5 |
| 5,5'-dichloro-2,2'-dihydroxy-3,3'-methanediyl-bis-benzenesulfonic acid |
| 5,5'-Dichlor-2,2'-dihydroxy-3,3'-methandiyl-bis-benzolsulfonsaeure |