4,4'-Methylene di-o-toluidine structure
|
Common Name | 4,4'-Methylene di-o-toluidine | ||
|---|---|---|---|---|
| CAS Number | 838-88-0 | Molecular Weight | 226.317 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 406.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H18N2 | Melting Point | 155-157 °C | |
| MSDS | USA | Flash Point | 238.9±26.8 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 4,4'-Diamino-3,3'-Dimethyldiphenylmethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.6±40.0 °C at 760 mmHg |
| Melting Point | 155-157 °C |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.317 |
| Flash Point | 238.9±26.8 °C |
| Exact Mass | 226.147003 |
| PSA | 52.04000 |
| LogP | 2.56 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | WECDUOXQLAIPQW-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2ccc(N)c(C)c2)ccc1N |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H317-H350-H410 |
| Precautionary Statements | P201-P273-P280-P308 + P313-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R45;R22;R43;R50/53 |
| Safety Phrases | S53-S45-S60-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | BY5300000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2921590090 |
| Precursor 7 | |
|---|---|
| DownStream 7 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Galectin-4-mediated transcytosis of transferrin receptor.
J. Cell Sci. 127(Pt 20) , 4457-69, (2014) Some native epithelia, for example, retinal pigment epithelium (RPE) and kidney proximal tubule (KPT), constitutively lack the basolateral sorting adaptor AP-1B; this results in many basolateral plasm... |
|
|
The carcinogenic effect of aromatic amines: an epidemiological study on the role of o-toluidine and 4,4'-methylene bis (2-methylaniline) in inducing bladder cancer in man.
Environ. Res. 27(2) , 241-54, (1982)
|
|
|
Aromatic amines of major industrial importance: use and occurrence.
IARC Sci. Publ. (40) , 51-74, (1981)
|
| 4,4'-Diamino-3,3'-dimethyldiphenylmethane |
| 4,4'-Methylene di-o-toluidine |
| Benzenamine, 4,4'-methylenebis[2-methyl- |
| MFCD00126963 |
| 4,4'-Methylen-bis(2-methyl aniline) |
| EINECS 212-658-8 |
| 4,4'-Methylenebis(2-methylaniline) |
| 4,4'-Methylene-di(o-toluidine) |
| 4-[(4-amino-3-methylphenyl)methyl]-2-methylaniline |
| 4,4'-methanediylbis(2-methylaniline) |
| Methane, bis[4-amino-3-methylphenyl]- |
| 4,4'-Methylene-bis(2-methylaniline) |