1-phenyl-2-(trifluoromethyl)quinolin-4-one
Modify Date: 2024-01-10 11:03:01
1-phenyl-2-(trifluoromethyl)quinolin-4-one structure
|
Common Name | 1-phenyl-2-(trifluoromethyl)quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 837364-35-9 | Molecular Weight | 289.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2-(trifluoromethyl)quinolin-4-one |
|---|
| Molecular Formula | C16H10F3NO |
|---|---|
| Molecular Weight | 289.25200 |
| Exact Mass | 289.07100 |
| PSA | 22.00000 |
| LogP | 4.00950 |
| InChIKey | NYUGPFRJWDZBOW-UHFFFAOYSA-N |
| SMILES | O=c1cc(C(F)(F)F)n(-c2ccccc2)c2ccccc12 |
|
~90%
1-phenyl-2-(tri... CAS#:837364-35-9 |
| Literature: Usachev, Boris I.; Sosnovskikh, Vyacheslav Ya. Journal of Fluorine Chemistry, 2004 , vol. 125, # 9 p. 1393 - 1395 |
|
~%
1-phenyl-2-(tri... CAS#:837364-35-9 |
| Literature: Usachev, Boris I.; Sosnovskikh, Vyacheslav Ya. Journal of Fluorine Chemistry, 2004 , vol. 125, # 9 p. 1393 - 1395 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |