S-(-)-7-Desmethyl-8-nitro Blebbistatin
Modify Date: 2025-09-03 17:06:59
S-(-)-7-Desmethyl-8-nitro Blebbistatin structure
|
Common Name | S-(-)-7-Desmethyl-8-nitro Blebbistatin | ||
|---|---|---|---|---|
| CAS Number | 856925-75-2 | Molecular Weight | 323.303 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 570.7±60.0 °C at 760 mmHg | |
| Molecular Formula | C17H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.9±32.9 °C | |
Use of S-(-)-7-Desmethyl-8-nitro Blebbistatin(S)-nitro-Blebbistatin is a more stable form of (–)-blebbistatin , which is a selective cell-permeable inhibitor of non-muscle myosin II ATPases. |
| Name | (3aS)-3a-hydroxy-7-nitro-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 570.7±60.0 °C at 760 mmHg |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.303 |
| Flash Point | 298.9±32.9 °C |
| Exact Mass | 323.090607 |
| PSA | 98.72000 |
| LogP | 0.92 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.737 |
| InChIKey | VIMYHNYWFMRDKQ-QGZVFWFLSA-N |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2N=C2N(c3ccccc3)CCC12O |
| S-(-)-7-Desmethyl-8-nitro Blebbistatin |
| (3aS)-1,2,3,3a-Tetrahydro-3a-hydroxy-7-nitro-1-phenyl-4H-pyrrolo[2,3-b]quinolin-4-one |
| 4H-Pyrrolo[2,3-b]quinolin-4-one, 1,2,3,3a-tetrahydro-3a-hydroxy-7-nitro-1-phenyl-, (3aS)- |
| (3aS)-3a-Hydroxy-7-nitro-1-phenyl-1,2,3,3a-tetrahydro-4H-pyrrolo[2,3-b]quinolin-4-one |