Amebucort
Modify Date: 2025-09-18 09:47:06
Amebucort structure
|
Common Name | Amebucort | ||
|---|---|---|---|---|
| CAS Number | 83625-35-8 | Molecular Weight | 488.61300 | |
| Density | 1.2g/cm3 | Boiling Point | 603.7ºC at 760 mmHg | |
| Molecular Formula | C28H40O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.7ºC | |
Use of AmebucortAmebucort is a synthetic glucocorticoid corticosteroid, may used for the research of inflammatory disorders. |
| Name | [(6S,8S,9S,10R,11S,13S,14S,17R)-17-(2-acetyloxyacetyl)-11-hydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Amebucort is a synthetic glucocorticoid corticosteroid, may used for the research of inflammatory disorders. |
|---|---|
| Related Catalog | |
| References |
[1]. Methods and reagents for the treatment of inflammatory disorders. US20050187200A1 |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 603.7ºC at 760 mmHg |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.61300 |
| Flash Point | 192.7ºC |
| Exact Mass | 488.27700 |
| PSA | 106.97000 |
| LogP | 3.94940 |
| Index of Refraction | 1.546 |
| InChIKey | QRRVOCXLQYLNEC-PPJDWOAVSA-N |
| SMILES | CCCC(=O)OC1(C(=O)COC(C)=O)CCC2C3CC(C)C4=CC(=O)CCC4(C)C3C(O)CC21C |
| Storage condition | 2-8℃ |
|
~%
Amebucort CAS#:83625-35-8 |
| Literature: Schering Aktiengesellschaft Patent: US4912098 A1, 1990 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Amebucort [INN] |
| 11beta,17,21-Trihydroxy-6alpha-methylpregn-4-ene-3,20-dione 21-acetate 17-butyrate |
| Amebucort |
| UNII-7YRF8G0G0F |