DIETHYL1,4-DIHYDRO-2,6-DIMETHYL-1,4-DIPHENYL-3,5-PYRIDINEDICARBOXYLATE structure
|
Common Name | DIETHYL1,4-DIHYDRO-2,6-DIMETHYL-1,4-DIPHENYL-3,5-PYRIDINEDICARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 83541-68-8 | Molecular Weight | 216.23100 | |
| Density | 1.055 g/mL at 25ºC(lit.) | Boiling Point | 236ºC | |
| Molecular Formula | C10H16O5-- | Melting Point | N/A | |
| MSDS | USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (-)-Diisopropyl-L-malate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 236ºC |
| Molecular Formula | C10H16O5-- |
| Molecular Weight | 216.23100 |
| Flash Point | >230 °F |
| Exact Mass | 216.10000 |
| PSA | 89.49000 |
| Index of Refraction | n20/D 1.43(lit.) |
| InChIKey | XYVHRFVONMVDGK-QMMMGPOBSA-N |
| SMILES | CC(C)OC(=O)CC(O)C(=O)OC(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918199090 |
|
~%
DIETHYL1,4-DIHY... CAS#:83541-68-8 |
| Literature: Journal of the American Chemical Society, , vol. 110, # 22 p. 7538 - 7539 |
|
~%
DIETHYL1,4-DIHY... CAS#:83541-68-8 |
| Literature: Journal of the American Chemical Society, , vol. 110, # 22 p. 7538 - 7539 |
|
~70%
DIETHYL1,4-DIHY... CAS#:83541-68-8 |
| Literature: Grossen, Peter; Herold, Peter; Mohr, Peter; Tamm, Christoph Helvetica Chimica Acta, 1984 , vol. 67, p. 1625 - 1629 |
|
~%
DIETHYL1,4-DIHY... CAS#:83541-68-8 |
| Literature: Journal of the Chemical Society, , vol. 73, p. 296 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| dipropan-2-yl (2S)-2-hydroxybutanedioate |
| MFCD00274300 |