Carbamothioic acid,N,N-dimethyl-, O-(2-nitrophenyl) ester
Modify Date: 2025-09-17 19:33:47
Carbamothioic acid,N,N-dimethyl-, O-(2-nitrophenyl) ester structure
|
Common Name | Carbamothioic acid,N,N-dimethyl-, O-(2-nitrophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 833-20-5 | Molecular Weight | 226.25200 | |
| Density | 1.326g/cm3 | Boiling Point | 316.8ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.4ºC | |
| Name | O-(2-nitrophenyl) N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 316.8ºC at 760 mmHg |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.25200 |
| Flash Point | 145.4ºC |
| Exact Mass | 226.04100 |
| PSA | 90.38000 |
| LogP | 2.34330 |
| Index of Refraction | 1.618 |
| InChIKey | QOCIFGBOWJADLR-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)Oc1ccccc1[N+](=O)[O-] |
|
~97%
Carbamothioic a... CAS#:833-20-5 |
| Literature: Moseley, Jonathan D.; Lenden, Philip; Lockwood, Mark; Ruda, Katinka; Sherlock, Jon-Paul; Thomson, Anthony D.; Gilday, John P. Organic Process Research and Development, 2008 , vol. 12, # 1 p. 30 - 40 |
|
~%
Carbamothioic a... CAS#:833-20-5 |
| Literature: Walter,W.; Bode,K.-D. Justus Liebigs Annalen der Chemie, 1965 , vol. 681, p. 64 - 84 |
CAS#:4875-10-9| O-(2-nitrophenyl) dimethylcarbamothioate |
| N,N-Dimethyl-thiocarbamidsaeure-O-(2-nitro-phenyl-ester) |
| N,N-Dimethyl-O-<2-nitro-phenyl>-thiourethan |
| O-2-nitrophenyl thiocarbamate |
| Dimethyl-thiocarbamidsaeure-O-(2-nitro-phenylester) |
| o-(2-nitrophenyl)-N,N-dimethylthiocarbamate |
| dimethyl-thiocarbamic acid O-(2-nitro-phenyl ester) |