LF 11 structure
|
Common Name | LF 11 | ||
|---|---|---|---|---|
| CAS Number | 832729-13-2 | Molecular Weight | 1529.79000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C69H112N26O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LF 11LF11 is a peptide with antibacterial activity[1]. |
| Name | L-Argininamide, L-phenylalanyl-L-glutaminyl-L-tryptophyl-L-glutaminyl-L-arginyl-L-asparaginyl-L-isoleucyl-L-arginyl-L-lysyl-L-valyl |
|---|
| Description | LF11 is a peptide with antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | LF11 acts as a basis for the development of endotoxin-neutralizing and antibacterial agents[1]. |
| References |
| Molecular Formula | C69H112N26O14 |
|---|---|
| Molecular Weight | 1529.79000 |
| Exact Mass | 1528.89000 |
| PSA | 716.89000 |
| LogP | 5.32460 |
| InChIKey | SIROSQHTQDVQTI-JDJCIBPGSA-N |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(CCCN=C(N)N)NC(=O)C(CCC(N)=O)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCCN)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(N)=O)C(C)C |