4-(4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-yl)aniline
Modify Date: 2025-09-28 19:23:45
4-(4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-yl)aniline structure
|
Common Name | 4-(4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-yl)aniline | ||
|---|---|---|---|---|
| CAS Number | 832075-88-4 | Molecular Weight | 331.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-methylsulfonyl-6-thiophen-2-ylpyrimidin-2-yl)aniline |
|---|
| Molecular Formula | C15H13N3O2S2 |
|---|---|
| Molecular Weight | 331.41300 |
| Exact Mass | 331.04500 |
| PSA | 122.56000 |
| LogP | 4.51980 |
| InChIKey | GFZOXMUCSPGTLH-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(-c2cccs2)nc(-c2ccc(N)cc2)n1 |
|
~%
4-(4-methylsulf... CAS#:832075-88-4 |
| Literature: Katiyar, Sanjay Babu; Bansal, Iti; Saxena; Chauhan Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 1 p. 47 - 50 |
|
~%
4-(4-methylsulf... CAS#:832075-88-4 |
| Literature: Katiyar, Sanjay Babu; Bansal, Iti; Saxena; Chauhan Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 1 p. 47 - 50 |
|
~%
4-(4-methylsulf... CAS#:832075-88-4 |
| Literature: Katiyar, Sanjay Babu; Bansal, Iti; Saxena; Chauhan Bioorganic and Medicinal Chemistry Letters, 2005 , vol. 15, # 1 p. 47 - 50 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |