Leukotriene B4 dimethylamide
Modify Date: 2025-08-20 21:32:08
Leukotriene B4 dimethylamide structure
|
Common Name | Leukotriene B4 dimethylamide | ||
|---|---|---|---|---|
| CAS Number | 83024-92-4 | Molecular Weight | 363.534 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 536.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H37NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2±30.1 °C | |
Use of Leukotriene B4 dimethylamideLTB4 dimethyl amide is a moderate inhibitor of LTB4-induced degranulation of human neutrophils |
| Name | leukotriene b4 dimethyl amide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 536.3±50.0 °C at 760 mmHg |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.534 |
| Flash Point | 278.2±30.1 °C |
| Exact Mass | 363.277344 |
| PSA | 60.77000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | BBJRTSLPWQUASB-UKODYPNASA-N |
| SMILES | CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)N(C)C |
| 6,8,10,14-Eicosatetraenamide, 5,12-dihydroxy-N,N-dimethyl-, (5S,6Z,8E,10E,12R,14Z)- |
| (5S,6Z,8E,10E,12R,14Z)-5,12-Dihydroxy-N,N-dimethyl-6,8,10,14-icosatetraenamide |