Platelet Factor 4 (58-70) (human)
Modify Date: 2025-08-25 13:03:44
Platelet Factor 4 (58-70) (human) structure
|
Common Name | Platelet Factor 4 (58-70) (human) | ||
|---|---|---|---|---|
| CAS Number | 82989-21-7 | Molecular Weight | 1572.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C76H133N17O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Platelet Factor 4 (58-70) (human)Platelet Factor 4 (58-70), human, a peptide based on the amino acid sequence corresponding to residues 58-70 of platelet factor-4 (PF-4), contains the major heparin-binding domain, which is not sufficient for full antiangiogenic activity[1]. |
| Name | platelet factor 4 (58-70) (human) |
|---|---|
| Synonym | More Synonyms |
| Description | Platelet Factor 4 (58-70), human, a peptide based on the amino acid sequence corresponding to residues 58-70 of platelet factor-4 (PF-4), contains the major heparin-binding domain, which is not sufficient for full antiangiogenic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C76H133N17O18 |
|---|---|
| Molecular Weight | 1572.97 |
| Exact Mass | 1572.00000 |
| PSA | 580.37000 |
| LogP | 7.01330 |
| InChIKey | SACBPCXTLNEHGC-ZIOXNNFISA-N |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CC(C)C)NC(=O)C1CCCN1)C(=O)NC(C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(CO)C(=O)O)C(C)CC |
| Storage condition | −20°C |
| Water Solubility | Very soluble (1000 g/L) (25 ºC) |
| WGK Germany | 3 |
|---|
| PRO-LEU-TYR-LYS-LYS-ILE-ILE-LYS-LYS-LEU-LEU-GLU-SER |
| H-PRO-LEU-TYR-LYS-LYS-ILE-ILE-LYS-LYS-LEU-LEU-GLU-SER-OH |
| platelet factor 4 fragment 58-70 human |
| L-Prolyl-L-leucyl-L-tyrosyl-L-lysyl-L-lysyl-L-isoleucyl-L-isoleucyl-L-lysyl-L-lysyl-L-leucyl-L-leucyl-L-alpha-glutamyl-L-serine |