Cyclo(Tyr-Leu) structure
|
Common Name | Cyclo(Tyr-Leu) | ||
|---|---|---|---|---|
| CAS Number | 82863-65-8 | Molecular Weight | 276.331 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 585.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.0±27.3 °C | |
Use of Cyclo(Tyr-Leu)Cyclo(Tyr-Leu) is a cyclic dipeptide[1]. |
| Name | 3-(4-Hydroxybenzyl)-6-isobutyl-2,5-piperazinedione |
|---|---|
| Synonym | More Synonyms |
| Description | Cyclo(Tyr-Leu) is a cyclic dipeptide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 585.6±40.0 °C at 760 mmHg |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.331 |
| Flash Point | 308.0±27.3 °C |
| Exact Mass | 276.147400 |
| LogP | 0.79 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | GENSLUDVKWKQMX-UHFFFAOYSA-N |
| SMILES | CC(C)CC1NC(=O)C(Cc2ccc(O)cc2)NC1=O |
| Storage condition | -20°C |
| 2,5-Piperazinedione, 3-[(4-hydroxyphenyl)methyl]-6-(2-methylpropyl)- |
| 3-(4-Hydroxybenzyl)-6-isobutyl-2,5-piperazinedione |