sebacic acid, compound with 2-aminoethanol
Modify Date: 2024-02-03 10:17:51
sebacic acid, compound with 2-aminoethanol structure
|
Common Name | sebacic acid, compound with 2-aminoethanol | ||
|---|---|---|---|---|
| CAS Number | 82801-62-5 | Molecular Weight | 263.33100 | |
| Density | N/A | Boiling Point | 510.1ºC at 760 mmHg | |
| Molecular Formula | C12H25NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.3ºC | |
| Name | 2-aminoethanol,decanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 510.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H25NO5 |
| Molecular Weight | 263.33100 |
| Flash Point | 262.3ºC |
| Exact Mass | 263.17300 |
| PSA | 120.85000 |
| LogP | 1.91410 |
| InChIKey | ZMKRMBQUHAYUCL-UHFFFAOYSA-N |
| SMILES | NCCO.O=C(O)CCCCCCCCC(=O)O |
| EINECS 280-045-2 |
| Sebacic acid,compound with 2-aminoethanol |
| Decanedioic acid,compd. with 2-aminoethanol |