sebacic acid, compound with 2,2',2''-nitrilotriethanol
Modify Date: 2025-08-25 11:40:04
sebacic acid, compound with 2,2',2''-nitrilotriethanol structure
|
Common Name | sebacic acid, compound with 2,2',2''-nitrilotriethanol | ||
|---|---|---|---|---|
| CAS Number | 70103-35-4 | Molecular Weight | 351.43600 | |
| Density | N/A | Boiling Point | 613.8ºC at 760 mmHg | |
| Molecular Formula | C16H33NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,decanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 613.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C16H33NO7 |
| Molecular Weight | 351.43600 |
| Flash Point | 325ºC |
| Exact Mass | 351.22600 |
| PSA | 138.53000 |
| LogP | 0.54170 |
| InChIKey | LDTRLQFRPHFLGA-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCCC(=O)O.OCCN(CCO)CCO |
| Sebacic acid,compound with 2,2',2''-nitrilotriethanol |
| EINECS 274-316-4 |
| EINECS 303-709-6 |
| Sebacic acid,compound with 2,2',2''-nitrilotriethanol (1:1) |