methyl 7-(5-acetyl-4,5-dihydrooxazol-3-yl)heptanoate structure
|
Common Name | methyl 7-(5-acetyl-4,5-dihydrooxazol-3-yl)heptanoate | ||
|---|---|---|---|---|
| CAS Number | 82781-81-5 | Molecular Weight | 255.31000 | |
| Density | 1.14g/cm3 | Boiling Point | 351.8ºC at 760 mmHg | |
| Molecular Formula | C13H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.1ºC | |
| Name | methyl 7-(5-acetyl-4,5-dihydro-1,2-oxazol-3-yl)heptanoate |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 351.8ºC at 760 mmHg |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31000 |
| Flash Point | 141.1ºC |
| Exact Mass | 255.14700 |
| PSA | 64.96000 |
| LogP | 1.66950 |
| Index of Refraction | 1.51 |
| InChIKey | TVDJKXWJMVPBKJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCCCCC1=NOC(C(C)=O)C1 |
|
~%
methyl 7-(5-ace... CAS#:82781-81-5 |
| Literature: Andersen, Soeren H.; Das, Nalin B.; Joergensen, Ruth D.; Kjeldsen, Gunhild; Knudsen, Jes S.; et al. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1982 , vol. 36, # 1 p. 1 - 14 |
|
~%
methyl 7-(5-ace... CAS#:82781-81-5 |
| Literature: Andersen, Soeren H.; Das, Nalin B.; Joergensen, Ruth D.; Kjeldsen, Gunhild; Knudsen, Jes S.; et al. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1982 , vol. 36, # 1 p. 1 - 14 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |