1-(2-METHYLPROPYL)-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE structure
|
Common Name | 1-(2-METHYLPROPYL)-4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-1H-PYRAZOLE | ||
|---|---|---|---|---|
| CAS Number | 827614-66-4 | Molecular Weight | 250.14500 | |
| Density | 1.003 g/mL at 25ºC(lit.) | Boiling Point | 248-249ºC(lit.) | |
| Molecular Formula | C13H23BN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118 °F | |
| Name | 1-Isobutyl-1H-pyrazole-4-boronic acid pinacol ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.003 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 248-249ºC(lit.) |
| Molecular Formula | C13H23BN2O2 |
| Molecular Weight | 250.14500 |
| Flash Point | 118 °F |
| Exact Mass | 250.18500 |
| PSA | 36.28000 |
| LogP | 1.83830 |
| Index of Refraction | n20/D 1.4740(lit.) |
| InChIKey | YMEBZRNYQBODKB-UHFFFAOYSA-N |
| SMILES | CC(C)Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 10-36/38 |
| Safety Phrases | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| HS Code | 2934999090 |
|
~%
1-(2-METHYLPROP... CAS#:827614-66-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 52, # 24 p. 7934 - 7937 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-methylpropyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |