1-(4-chlorophenyl)-2-(2-methylpyridin-1-ium-1-yl)ethanone,bromide structure
|
Common Name | 1-(4-chlorophenyl)-2-(2-methylpyridin-1-ium-1-yl)ethanone,bromide | ||
|---|---|---|---|---|
| CAS Number | 82746-43-8 | Molecular Weight | 326.61600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-2-(2-methylpyridin-1-ium-1-yl)ethanone,bromide |
|---|
| Molecular Formula | C14H13BrClNO |
|---|---|
| Molecular Weight | 326.61600 |
| Exact Mass | 324.98700 |
| PSA | 20.95000 |
| InChIKey | XOQIPRYDBXLZKQ-UHFFFAOYSA-M |
| SMILES | Cc1cccc[n+]1CC(=O)c1ccc(Cl)cc1.[Br-] |
|
~74%
1-(4-chlorophen... CAS#:82746-43-8 |
| Literature: Anitha; Rajan Journal of the Indian Chemical Society, 1989 , vol. 66, # 7 p. 460 - 462 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |