(NZ)-N-[1-amino-3-[(4-methoxyphenyl)-methyl-amino]propan-2-ylidene]hydroxylamine
Modify Date: 2025-09-28 12:12:06
![(NZ)-N-[1-amino-3-[(4-methoxyphenyl)-methyl-amino]propan-2-ylidene]hydroxylamine Structure](https://image.chemsrc.com/caspic/357/82740-35-0.png)
(NZ)-N-[1-amino-3-[(4-methoxyphenyl)-methyl-amino]propan-2-ylidene]hydroxylamine structure
|
Common Name | (NZ)-N-[1-amino-3-[(4-methoxyphenyl)-methyl-amino]propan-2-ylidene]hydroxylamine | ||
|---|---|---|---|---|
| CAS Number | 82740-35-0 | Molecular Weight | 223.27200 | |
| Density | 1.14g/cm3 | Boiling Point | 410.5ºC at 760 mmHg | |
| Molecular Formula | C11H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.1ºC | |
| Name | (NE)-N-[1-amino-3-(4-methoxy-N-methylanilino)propan-2-ylidene]hydroxylamine |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 410.5ºC at 760 mmHg |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.27200 |
| Flash Point | 202.1ºC |
| Exact Mass | 223.13200 |
| PSA | 71.08000 |
| LogP | 1.62060 |
| Index of Refraction | 1.541 |
| InChIKey | KLMDLDDRQNBXTH-UKTHLTGXSA-N |
| SMILES | COc1ccc(N(C)CC(CN)=NO)cc1 |
|
~%
(NZ)-N-[1-amino... CAS#:82740-35-0 |
| Literature: Temple, Carroll; Wheeler, Glynn P.; Elliott, Robert D.; Rose, Jerry D.; Kussner, Conrad L.; et al. Journal of Medicinal Chemistry, 1982 , vol. 25, # 9 p. 1045 - 1050 |
![2-[(2Z)-2-hydroxyimino-3-[(4-methoxyphenyl)-methyl-amino]propyl]isoindole-1,3-dione structure](https://image.chemsrc.com/caspic/422/82585-46-4.png)
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![Carbamic acid,[5-amino-1,2-dihydro-3-[[(4-methoxyphenyl)methylamino]methyl]pyrido[3,4-b]pyrazin-7-yl]-,ethyl ester (9CI) structure](https://image.chemsrc.com/caspic/115/82585-90-8.png)
CAS#:82585-90-8