Carbamic acid,[6-amino-4-[[2-(hydroxyimino)-3-[(4-methoxyphenyl)methylamino]propyl]amino]-5-nitro-2-pyridinyl]-,ethyl ester (9CI) structure
|
Common Name | Carbamic acid,[6-amino-4-[[2-(hydroxyimino)-3-[(4-methoxyphenyl)methylamino]propyl]amino]-5-nitro-2-pyridinyl]-,ethyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 82585-58-8 | Molecular Weight | 447.44500 | |
| Density | 1.4g/cm3 | Boiling Point | 689.7ºC at 760mmHg | |
| Molecular Formula | C19H25N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 370.9ºC | |
| Name | ethyl N-[6-amino-4-[[(2Z)-2-hydroxyimino-3-(4-methoxy-N-methylanilino)propyl]amino]-5-nitropyridin-2-yl]carbamate |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 689.7ºC at 760mmHg |
| Molecular Formula | C19H25N7O6 |
| Molecular Weight | 447.44500 |
| Flash Point | 370.9ºC |
| Exact Mass | 447.18700 |
| PSA | 180.15000 |
| LogP | 3.77790 |
| Index of Refraction | 1.627 |
| InChIKey | OJLUEAILLNPUMF-WYMPLXKRSA-N |
| SMILES | CCOC(=O)Nc1cc(NCC(CN(C)c2ccc(OC)cc2)=NO)c([N+](=O)[O-])c(N)n1 |
|
~%
Carbamic acid,[... CAS#:82585-58-8 |
| Literature: Temple, Carroll; Wheeler, Glynn P.; Elliott, Robert D.; Rose, Jerry D.; Kussner, Conrad L.; et al. Journal of Medicinal Chemistry, 1982 , vol. 25, # 9 p. 1045 - 1050 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |