N-[3-(dimethoxymethyl)pyridin-2-yl]-2,2-dimethylpropanamide structure
|
Common Name | N-[3-(dimethoxymethyl)pyridin-2-yl]-2,2-dimethylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 824429-53-0 | Molecular Weight | 252.30900 | |
| Density | 1.106g/cm3 | Boiling Point | 392.8ºC at 760 mmHg | |
| Molecular Formula | C13H20N2O3 | Melting Point | 61.3-61.5ºC | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-[3-(dimethoxymethyl)pyridin-2-yl]-2,2-dimethylpropanamide |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760 mmHg |
| Melting Point | 61.3-61.5ºC |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.30900 |
| Flash Point | 191.3ºC |
| Exact Mass | 252.14700 |
| PSA | 60.45000 |
| LogP | 2.43060 |
| Index of Refraction | 1.527 |
| InChIKey | BINVXEAOQKKXFE-UHFFFAOYSA-N |
| SMILES | COC(OC)c1cccnc1NC(=O)C(C)(C)C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |