Pyrido[4',3':5,6]pyrano[3,4-b]indole,1,2,3,4,4a,6,7,11c-octahydro-3,6,6-trimethyl- structure
|
Common Name | Pyrido[4',3':5,6]pyrano[3,4-b]indole,1,2,3,4,4a,6,7,11c-octahydro-3,6,6-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 82420-17-5 | Molecular Weight | 270.36900 | |
| Density | 1.121g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.8ºC | |
| Name | 3,6,6-Trimethyl-1,2,3,4,4a,6,7,11c-octahydropyrido<3,4-b>pyrano<3,4-b>indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.36900 |
| Flash Point | 215.8ºC |
| Exact Mass | 270.17300 |
| PSA | 28.26000 |
| LogP | 3.15880 |
| Index of Refraction | 1.593 |
| InChIKey | OOCBOEDELGAYRA-UHFFFAOYSA-N |
| SMILES | CN1CCC2c3c([nH]c4ccccc34)C(C)(C)OC2C1 |
|
~58%
Pyrido[4',3':5,... CAS#:82420-17-5 |
| Literature: Freter; Fuchs Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 2 p. 377 - 379 |
|
~%
Pyrido[4',3':5,... CAS#:82420-17-5 |
| Literature: Freter; Fuchs Journal of Heterocyclic Chemistry, 1982 , vol. 19, # 2 p. 377 - 379 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,6,6-Trimethyl-1,2,3,4,4a,6,7,11c-octahydropyrido[3,4-b]pyrano[3,4-b]indole |
| 3,6,6-Trimethyl-1,2,3,4,4a,6,7,11c-octahydropyrido[4',3':5,6]pyrano[3,4-b]indole |