Oxygen-fluorine acid structure
|
Common Name | Oxygen-fluorine acid | ||
|---|---|---|---|---|
| CAS Number | 82419-35-0 | Molecular Weight | 281.212 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 459.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H9F2NO4 | Melting Point | 320-322ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 231.5±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 9,10-Difluoro-2,3-dihydro-3-methyl-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 459.2±45.0 °C at 760 mmHg |
| Melting Point | 320-322ºC(lit.) |
| Molecular Formula | C13H9F2NO4 |
| Molecular Weight | 281.212 |
| Flash Point | 231.5±28.7 °C |
| Exact Mass | 281.049957 |
| PSA | 68.53000 |
| LogP | 0.99 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | NVKWWNNJFKZNJO-UHFFFAOYSA-N |
| SMILES | CC1COc2c(F)c(F)cc3c(=O)c(C(=O)O)cn1c23 |
| Storage condition | -20?C Freezer |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Evaluation of 3-carboxy-4(1H)-quinolones as inhibitors of human protein kinase CK2.
J. Med. Chem. 49 , 6443-50, (2006) Due to the emerging role of protein kinase CK2 as a molecule that participates not only in the development of some cancers but also in viral infections and inflammatory failures, small organic inhibit... |
|
|
Effect of N-1/c-8 ring fusion and C-7 ring structure on fluoroquinolone lethality.
Antimicrob. Agents Chemother. 54 , 5214-21, (2010) Quinolones rapidly kill bacteria by two mechanisms, one that requires protein synthesis and one that does not. The latter, which is measured as lethal action in the presence of the protein synthesis i... |
|
|
On the relationship between the two branches of the kynurenine pathway in the rat brain in vivo. Amori L, et al.
J. Neurochem. 109(2) , 316-325, (2009)
|
| 7H-1,4-Oxazino[2,3,4-ij]quinoline-6-carboxylic acid, 9,10-difluoro-2,3-dihydro-3-methyl-7-oxo- |
| MFCD00226106 |
| UNII:501W86694Z |
| 9,10-Difluoro-3-methyl-7-oxo-2,3-dihydro-7H-[1,4]oxazino[2,3,4-ij]quinoline-6-carboxylic acid |
| Oxygen-fluorine acid |