ethyl 4-(4-fluorophenyl)-4-hydroxypiperidine-1-carboxylate structure
|
Common Name | ethyl 4-(4-fluorophenyl)-4-hydroxypiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 82387-58-4 | Molecular Weight | 267.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(4-fluorophenyl)-4-hydroxypiperidine-1-carboxylate |
|---|
| Molecular Formula | C14H18FNO3 |
|---|---|
| Molecular Weight | 267.29600 |
| Exact Mass | 267.12700 |
| PSA | 49.77000 |
| LogP | 2.20350 |
| InChIKey | QKWIBMSBOAYDMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC(O)(c2ccc(F)cc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~91%
ethyl 4-(4-fluo... CAS#:82387-58-4 |
| Literature: Protiva; Kopicova; Grimova Collection of Czechoslovak Chemical Communications, 1982 , vol. 47, # 2 p. 636 - 643 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |