Sulforhodamine 101 acid chloride structure
|
Common Name | Sulforhodamine 101 acid chloride | ||
|---|---|---|---|---|
| CAS Number | 82354-19-6 | Molecular Weight | 625.15500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H29ClN2O6S2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Danger | |
Use of Sulforhodamine 101 acid chlorideSulforhodamine 101 sulfonyl chloride is a fluorescent probe that binds to free amino groups and is a derivative of sulforhodamine 101. It displays excitation/emission maxima of 585/602 nm, respectively. Sulforhodamine 101 sulfonyl chloride has commonly been used as a fluorescent conjugate on antibodies or proteins for the detection of proteins via fluorescent microscopy and flow cytometry applications. |
| Name | Texas red |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C31H29ClN2O6S2 |
|---|---|
| Molecular Weight | 625.15500 |
| Exact Mass | 624.11600 |
| PSA | 123.58000 |
| LogP | 5.27990 |
| InChIKey | MPLHNVLQVRSVEE-UHFFFAOYSA-N |
| SMILES | O=S(=O)([O-])c1cc(S(=O)(=O)Cl)ccc1C1=c2cc3c4c(c2Oc2c1cc1c5c2CCCN5CCC1)CCC[N+]=4CCC3 |
| Storage condition | -20°C |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H319-H332-H351-H361d-H372 |
| Precautionary Statements | P201-P261-P304 + P340 + P312-P305 + P351 + P338-P308 + P313 |
| Hazard Codes | Xn |
| Risk Phrases | R20;R40;R48/20/22 |
| Safety Phrases | S36/37 |
| RIDADR | NONH for all modes of transport |
|
Distribution of acetylcholine and catecholamines in fish gills and their potential roles in the hypoxic ventilatory response.
Acta Histochem. 115(2) , 158-69, (2013) Carotid body glomus cells in mammals contain a plethora of different neurochemicals. Several hypotheses exist to explain their roles in oxygen-chemosensing. In the present study we assessed the distri... |
|
|
Cerebellar fastigial nuclear GABAergic projections to the hypothalamus modulate immune function.
Brain. Behav. Immun. 27(1) , 80-90, (2013) Our previous work has shown that the cerebellar fastigial nucleus (FN) is involved in modulation of lymphocyte function. Herein, we investigated effect of FN γ-aminobutyric acid (GABA)-ergic projectio... |
|
|
In vivo evaluation of venular glycocalyx during hemorrhagic shock in rats using intravital microscopy.
Microvasc. Res. 85 , 128-33, (2013) Hemorrhage is responsible for a large percentage of trauma-related deaths but the mechanisms underlying tissue ischemia are complex and not well understood. Despite the evidence linking glycocalyx deg... |
| MFCD00012406 |
| Sulforhodamine 640 |
| Sulforhodamine 101 acid chloride |
| Sulforhodamine 101 sulfonyl chloride |