Deslorelin Acetate structure
|
Common Name | Deslorelin Acetate | ||
|---|---|---|---|---|
| CAS Number | 82318-06-7 | Molecular Weight | 1342.502 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C66H87N17O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Deslorelin AcetateDeslorelin is a gonadotropin releasing hormone super-agonist (GnRH agonist) also known as an LHRH agonist. It stops the production of sex hormones (testosterone and oestrogen). It is currently approved for use in veterinary medicine and is used to induce ovulation in mares as part of the artificial insemination process. It is also used to stabilize high-risk pregnancies, mainly of livestock. Unlike other GnRH agonists, which are mainly used to inhibit luteinizing hormone and follicle-stimulating hormone by their ultimate downregulation of the pituitary gland. |
| Name | 679007NR5C |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C66H87N17O14 |
|---|---|
| Molecular Weight | 1342.502 |
| Exact Mass | 1341.661865 |
| InChIKey | LYCYLGFSIXIXAB-NUZRHMIVSA-N |
| SMILES | CC(=O)O.CCNC(=O)C1CCCN1C(=O)C(CCCN=C(N)N)NC(=O)C(CC(C)C)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1 |
| 5-Oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-tryptophyl-L-leucyl-L-arginyl-N-ethyl-L-prolinamide acetate (1:1) |
| 679007NR5C |
| Deslorelin acetate |
| L-Prolinamide, 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-tryptophyl-L-leucyl-L-arginyl-N-ethyl-, acetate (1:1) |
| MFCD09842868 |
| Suprelorin |
| Ovuplant |
| UNII-679007NR5C |