Ethyl (2-(4-methoxyphenyl)imidazo(2,1-b)(1,3)benzothiazol-7-yl)acetate structure
|
Common Name | Ethyl (2-(4-methoxyphenyl)imidazo(2,1-b)(1,3)benzothiazol-7-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 81950-30-3 | Molecular Weight | 366.43400 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.43400 |
| Exact Mass | 366.10400 |
| PSA | 81.07000 |
| LogP | 4.33020 |
| Index of Refraction | 1.656 |
| InChIKey | UHGMWULLGNTGGY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc2c(c1)sc1nc(-c3ccc(OC)cc3)cn12 |
|
~58%
Ethyl (2-(4-met... CAS#:81950-30-3 |
| Literature: Sawhney, S. N.; Kodali, Dharma R.; Dhindsa, G. S.; Singh, S. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1982 , vol. 21, # 2 p. 134 - 138 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Ethyl (2-(4-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-7-yl)acetate |