(4-METHYLBENZYL)THIO]ACETICACID structure
|
Common Name | (4-METHYLBENZYL)THIO]ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 81416-37-7 | Molecular Weight | 426.47200 | |
| Density | 1.27g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H17F3O3S2 | Melting Point | 98-102ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (4-methylphenyl)-diphenylsulfanium,trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Melting Point | 98-102ºC(lit.) |
| Molecular Formula | C20H17F3O3S2 |
| Molecular Weight | 426.47200 |
| Exact Mass | 426.05700 |
| PSA | 90.88000 |
| LogP | 6.22260 |
| Index of Refraction | 1.547 |
| InChIKey | AWOATHYNVXCSGP-UHFFFAOYSA-M |
| SMILES | Cc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,C |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S36 |
| RIDADR | NONH for all modes of transport |
|
~91%
(4-METHYLBENZYL... CAS#:81416-37-7 |
| Literature: Korea Kumho Petrochemical Co. Ltd. Patent: EP972761 A1, 2000 ; |
|
~93%
(4-METHYLBENZYL... CAS#:81416-37-7 |
| Literature: Endo, Yasuyuki; Shudo, Koichi; Okamoto, Toshihiko Chemical & Pharmaceutical Bulletin, 1981 , vol. 29, # 12 p. 3753 - 3755 |
|
~49%
(4-METHYLBENZYL... CAS#:81416-37-7 |
| Literature: Miller, R. D.; Renaldo, A. F.; Ito, H. Journal of Organic Chemistry, 1988 , vol. 53, # 23 p. 5571 - 5573 |
| (4-METHYLPHENYL)DIPHENYL SULFONIUM TRIFLUOROMETHANESULFONATE |
| diphenyl(4-methylphenyl)sulfonium trifluoromethanesulfonate |
| p-tolyldiphenylsulfonium trifluoromethanesulfonate |
| diphenyl(4-methylphenyl)sulfonium triflate |
| diphenyl-p-tolylsulfonium triflate |
| (4-Methylphenyl)diphenylsulfonium triflate |
| diphenyl(4-methylphenyl)sulfonium trifluoromethanesulfonic acid |
| diphenyl-p-toluenylsulfonium triflate |
| MFCD02683564 |