1,8-Dibromohexadecafluorooctane
Modify Date: 2025-08-25 11:36:05
1,8-Dibromohexadecafluorooctane structure
|
Common Name | 1,8-Dibromohexadecafluorooctane | ||
|---|---|---|---|---|
| CAS Number | 812-58-8 | Molecular Weight | 559.86800 | |
| Density | 2 g/cm3 | Boiling Point | 180 °C | |
| Molecular Formula | C8Br2F16 | Melting Point | 40 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,8-Dibromoperfluorooctane |
|---|---|
| Synonym | More Synonyms |
| Density | 2 g/cm3 |
|---|---|
| Boiling Point | 180 °C |
| Melting Point | 40 °C |
| Molecular Formula | C8Br2F16 |
| Molecular Weight | 559.86800 |
| Exact Mass | 557.81100 |
| LogP | 6.77360 |
| InChIKey | LYRJPHOHVRHNQH-UHFFFAOYSA-N |
| SMILES | FC(F)(Br)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36/37/39 |
|
~%
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 38, # 5 p. 907 - 909 |
|
~%
Detail
|
| Literature: Journal of Fluorine Chemistry, , vol. 127, # 2 p. 240 - 248 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,8-dibromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane |
| MFCD00153111 |