Semax structure
|
Common Name | Semax | ||
|---|---|---|---|---|
| CAS Number | 80714-61-0 | Molecular Weight | 813.92000 | |
| Density | 1.391g/cm3 | Boiling Point | 1335.2ºC at 760 mmHg | |
| Molecular Formula | C37H51N9O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 761.3ºC | |
Use of SemaxMEHFPGP is a nootropic neuroprotective peptide. MEHFPGP can be used in the research of brain stroke[1][2]. |
| Name | L-Methionyl-L-α-glutamylhistidyl-L-phenylalanyl-L-prolylglycyl-L- proline |
|---|---|
| Synonym | More Synonyms |
| Description | MEHFPGP is a nootropic neuroprotective peptide. MEHFPGP can be used in the research of brain stroke[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | MEHFPGP (25 μM and 100 μM, 48 h) reduces the Abeta oligomers (100 μM) levels[2]. MEHFPGP (100 nM) increase survival of cholinergic basal forebrain neurons[3]. MEHFPGP (100 nM) stimulates activity of choline acetyltransferase in dissociated basal forebrain tissue culture[3]. MEHFPGP (10 μM, 24 h) stimulates the synthesis of brain-derived neurotrophic factor (BDNF) in astrocytes cultured from rat basal forebrain[4]. |
| In Vivo | MEHFPGP (Semax, 100 μg/kg, i.p.) promotes the formation and functioning of the vascular system in Ischemia (pMCAO) rats[1]. MEHFPGP (50 µg and 250 µg, 100 µL/kg, intranasal inhalation) increases levels of b BDNF protein in rat basal forebrain[5]. Animal Model: Ischemia (pMCAO) rats[1]. Dosage: 100 μg/kg Administration: Intraperitoneal injections (i.p.), performed 15 min, 1, 4 and 8 h after permanent middle cerebral artery occlusion (pMCAO). Result: Increased the immune response (upregulation of transcripts). Animal Model: Rats[5] Dosage: 50 µg, 250 µg, 100 µL/kg Administration: Intranasal inhalation Result: Increased levels of brain-derived neurotrophic factor (BDNF) protein in rat basal forebrain. |
| Density | 1.391g/cm3 |
|---|---|
| Boiling Point | 1335.2ºC at 760 mmHg |
| Molecular Formula | C37H51N9O10S |
| Molecular Weight | 813.92000 |
| Flash Point | 761.3ºC |
| Exact Mass | 813.34800 |
| PSA | 325.58000 |
| LogP | 2.71460 |
| Index of Refraction | 1.617 |
| InChIKey | AFEHBIGDWIGTEH-AQRCPPRCSA-N |
| SMILES | CSCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)NCC(=O)N1CCCC1C(=O)O |
| 1,3,5-tris[6-isocyanatohexyl]-2,4,6-trioxo-s-triazine |
| HMDI trimer |
| tris(6-isocyanatohexyl) isocyanurate |
| L-2-methylleucine methyl ester |
| 1,3,5-Tris(isocyanatohexamethylene)isocyanurate |
| Lys(Z)-OBzl.TosOH |
| H-MeLeu-OMe |
| hexamethylene diisocyanate isocyanurate |
| trimeric hexamethylene diisocyanate |
| H-Lys(Z)-OBzl*TosOH |
| H-Met-Glu-His-Phe-Pro-Gly-Pro |
| TsOH*H-Lys(Z)-OBzl |
| Desmodur N 3390 BA |
| Met-Glu-His-Phe-Pro-Gly-Pro |