Fluocinolone
Modify Date: 2025-08-25 19:26:26
Fluocinolone structure
|
Common Name | Fluocinolone | ||
|---|---|---|---|---|
| CAS Number | 807-38-5 | Molecular Weight | 412.42400 | |
| Density | 1.45g/cm3 | Boiling Point | 589ºC at 760 mmHg | |
| Molecular Formula | C21H26F2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310ºC | |
Use of FluocinoloneFluocinolone is a corticosteroid that is used to relieve redness, itching, swelling, or other discomfort caused by skin conditions[1]. |
| Name | (6α,11β,16α)-6,9-Difluoro-11,16,17,21-tetrahydroxypregna-1,4-dien e-3,20-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Fluocinolone is a corticosteroid that is used to relieve redness, itching, swelling, or other discomfort caused by skin conditions[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 589ºC at 760 mmHg |
| Molecular Formula | C21H26F2O6 |
| Molecular Weight | 412.42400 |
| Flash Point | 310ºC |
| Exact Mass | 412.17000 |
| PSA | 115.06000 |
| LogP | 0.56850 |
| Index of Refraction | 1.603 |
| InChIKey | UUOUOERPONYGOS-CLCRDYEYSA-N |
| SMILES | CC12C=CC(=O)C=C1C(F)CC1C3CC(O)C(O)(C(=O)CO)C3(C)CC(O)C12F |
| 1-(2'-Hydroxyethyl)-2-(p-fluorphenyl)-5-nitroimidazol |
| fluocinolone tetraol |
| fluocinolone |
| 2-[2-(4-fluoro-phenyl)-5-nitro-imidazol-1-yl]-ethanol |
| 1H-Imidazole-1-ethanol,2-(4-fluorophenyl)-5-nitro |
| 1-(2-hydroxyethyl)-2-(4-fluorophenyl)-5-nitroimidazole |
| Flunidazol |
| FLUNIDAZOLE |
| Imidazole-1-ethanol,2-(p-fluorophenyl)-5-nitro |
| 2-(4-Fluorphenyl)-1-(2-hydroxyethyl)-5-nitroimidazol |
| 2-(p-Fluorophenyl)-5-nitroimidazole-1-ethanol |
| 5-NI |
| 2-(p-fluorophenyl)-1-(2'-hydroxyethyl)-5-nitroimidazole |
| EINECS 212-362-9 |