demephion structure
|
Common Name | demephion | ||
|---|---|---|---|---|
| CAS Number | 8065-62-1 | Molecular Weight | 432.51700 | |
| Density | 1.2000 (rough estimate) | Boiling Point | N/A | |
| Molecular Formula | C10H26O6P2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -18ºC | |
| Name | demephion |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2000 (rough estimate) |
|---|---|
| Molecular Formula | C10H26O6P2S4 |
| Molecular Weight | 432.51700 |
| Flash Point | -18ºC |
| Exact Mass | 432.00900 |
| PSA | 190.83000 |
| LogP | 5.01740 |
| Index of Refraction | 1.5210 (estimate) |
| InChIKey | ZIBCESDMUREVIU-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)SCCSC.COP(=S)(OC)OCCSC |
| Storage condition | 2-8°C |
| Hazard Codes | T+,N,Xn,F |
|---|---|
| Risk Phrases | 24-28-67-65-50/53-38-11 |
| Safety Phrases | 28-36/37-45-62-61-60 |
| RIDADR | UN 3018 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2930909062 |
| HS Code | 2930909062 |
|---|---|
| Summary | 2930909062 s-((tert-butylthio)methyl) o,o-diethyl phosphorodithioate |
| reaction mixture of demephion-o and demephion-s (bsi,iso) |
| Demephion solution |
| dimethyl S-2-methylthioethyl phosphorothioate |
| TINOX |