6-alpha-Fluoro-isoflupredone structure
|
Common Name | 6-alpha-Fluoro-isoflupredone | ||
|---|---|---|---|---|
| CAS Number | 806-29-1 | Molecular Weight | 396.425 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 568.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H26F2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.5±30.1 °C | |
| Name | 6-α-Fluoro-isoflupredone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 568.3±50.0 °C at 760 mmHg |
| Molecular Formula | C21H26F2O5 |
| Molecular Weight | 396.425 |
| Flash Point | 297.5±30.1 °C |
| Exact Mass | 396.174835 |
| PSA | 94.83000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | ABUISBDTYAZRHY-RBKZJGKHSA-N |
| SMILES | CC12C=CC(=O)C=C1C(F)CC1C3CCC(O)(C(=O)CO)C3(C)CC(O)C12F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2937210000 |
|
~%
6-alpha-Fluoro-... CAS#:806-29-1 |
| Literature: Chemistry and Industry (London, United Kingdom), , p. 1002 US2838537 , ; |
|
~%
6-alpha-Fluoro-... CAS#:806-29-1 |
| Literature: US2838537 , ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2937210000 |
|---|
| Pregna-1,4-diene-3,20-dione, 6,9-difluoro-11,17,21-trihydroxy-, (6α,11β)- |
| (6α,11β)-6,9-Difluoro-11,17,21-trihydroxypregna-1,4-diene-3,20-dione |
| 6a,9-difluoro-11b,17,21-trihydroxypregna-1,4-diene-3,20-dione |
| 6alpha,9-difluoro-11beta,17,21-trihydroxypregna-1,4-diene-3,20-dione |
| 6-alpha-Fluoro-isoflupredone |
| EINECS 212-360-8 |