5-(2-CHLOROPHENYL)-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 5-(2-CHLOROPHENYL)-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 80590-50-7 | Molecular Weight | 225.69800 | |
| Density | 1.43g/cm3 | Boiling Point | 306ºC at 760 mmHg | |
| Molecular Formula | C9H8ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.8ºC | |
| Name | 3-(2-chlorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 306ºC at 760 mmHg |
| Molecular Formula | C9H8ClN3S |
| Molecular Weight | 225.69800 |
| Flash Point | 138.8ºC |
| Exact Mass | 225.01300 |
| PSA | 69.51000 |
| LogP | 2.42420 |
| Index of Refraction | 1.696 |
| InChIKey | DNWADAKXAKNOFG-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccccc2Cl)n[nH]c1=S |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~74%
5-(2-CHLOROPHEN... CAS#:80590-50-7 |
| Literature: Kane; Staeger; Dalton; Miller; Dudley; Ogden; Kehne; Ketteler; McCloskey; Senyah; Chmielewski Journal of Medicinal Chemistry, 1994 , vol. 37, # 1 p. 125 - 132 |
|
~%
5-(2-CHLOROPHEN... CAS#:80590-50-7 |
| Literature: Kane; Staeger; Dalton; Miller; Dudley; Ogden; Kehne; Ketteler; McCloskey; Senyah; Chmielewski Journal of Medicinal Chemistry, 1994 , vol. 37, # 1 p. 125 - 132 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |