Boc-D-2,4-Diaminobutyric Acid structure
|
Common Name | Boc-D-2,4-Diaminobutyric Acid | ||
|---|---|---|---|---|
| CAS Number | 80445-78-9 | Molecular Weight | 218.250 | |
| Density | 1.16 g/cm3 | Boiling Point | 385.5±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9±26.5 °C | |
| Name | Boc-D-2,4-Diaminobutyric Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16 g/cm3 |
|---|---|
| Boiling Point | 385.5±37.0 °C at 760 mmHg |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.250 |
| Flash Point | 186.9±26.5 °C |
| Exact Mass | 218.126663 |
| PSA | 101.65000 |
| LogP | 0.75 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| InChIKey | MDCPCLPRWLKUIQ-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCN)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate |
| (2S)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate |
| 1-Propanaminium, 3-carboxy-3-[[(1,1-dimethylethoxy)carbonyl]amino]-, inner salt, (3S)- |
| 1-Propanaminium, 3-carboxy-3-[[(1,1-dimethylethoxy)carbonyl]amino]-, inner salt, (3R)- |
| Boc-D-2,4-diaminobutyric acid |
| (2R)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| Boc-D-Dab-OH |